C19H19FN4O4 — CID 161190568
5-amino-6-fluoro-8-methoxy-4-oxo-7-(3-pyridin-2-ylpropylamino)-1H-quinoline-3-carboxylic acid (PubChem CID 161190568) has the molecular formula C19H19FN4O4 and a molecular weight of 386.38 g/mol. Its IUPAC name is 5-amino-6-fluoro-8-methoxy-4-oxo-7-(3-pyridin-2-ylpropylamino)-1H-quinoline-3-carboxylic acid.
| Compound Name | 5-amino-6-fluoro-8-methoxy-4-oxo-7-(3-pyridin-2-ylpropylamino)-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 161190568 |
| Molecular Formula | C19H19FN4O4 |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 5-amino-6-fluoro-8-methoxy-4-oxo-7-(3-pyridin-2-ylpropylamino)-1H-quinoline-3-carboxylic acid |
| SMILES | COc1c(NCCCc2ccccn2)c(F)c(N)c2c(=O)c(C(=O)O)c[nH]c12 |
| InChI | InChI=1S/C19H19FN4O4/c1-28-18-15-12(17(25)11(9-24-15)19(26)27)14(21)13(20)16(18)23-8-4-6-10-5-2-3-7-22-10/h2-3,5,7,9,23H,4,6,8,21H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | FEKQDAGFXBKDGV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|