C22H22FN5O5 — CID 59003010
(2S)-8-amino-7-fluoro-2-methyl-10-oxo-6-[3-(pyridine-2-carbonylamino)propylamino]-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid (PubChem CID 59003010) has the molecular formula C22H22FN5O5 and a molecular weight of 455.45 g/mol. Its IUPAC name is (2S)-8-amino-7-fluoro-2-methyl-10-oxo-6-[3-(pyridine-2-carbonylamino)propylamino]-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid.
| Compound Name | (2S)-8-amino-7-fluoro-2-methyl-10-oxo-6-[3-(pyridine-2-carbonylamino)propylamino]-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
|---|---|
| PubChem CID | 59003010 |
| Molecular Formula | C22H22FN5O5 |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | (2S)-8-amino-7-fluoro-2-methyl-10-oxo-6-[3-(pyridine-2-carbonylamino)propylamino]-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
| SMILES | C[C@H]1COc2c(NCCCNC(=O)c3ccccn3)c(F)c(N)c3c(=O)c(C(=O)O)cn1c23 |
| InChI | InChI=1S/C22H22FN5O5/c1-11-10-33-20-17(26-7-4-8-27-21(30)13-5-2-3-6-25-13)15(23)16(24)14-18(20)28(11)9-12(19(14)29)22(31)32/h2-3,5-6,9,11,26H,4,7-8,10,24H2,1H3,(H,27,30)(H,31,32)/t11-/m0/s1 |
| InChIKey | KACPACLVYPGENW-NSHDSACASA-N |
| XLogP | 2.00 |
| TPSA | 148.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|