C27H28FN5O3 — CID 143541610
11-acetyl-8-amino-6-[2-[(2,6-dimethylquinolin-4-yl)amino]ethylamino]-7-fluoro-2-methyl-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-10-one (PubChem CID 143541610) has the molecular formula C27H28FN5O3 and a molecular weight of 489.55 g/mol. Its IUPAC name is 11-acetyl-8-amino-6-[2-[(2,6-dimethylquinolin-4-yl)amino]ethylamino]-7-fluoro-2-methyl-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-10-one.
| Compound Name | 11-acetyl-8-amino-6-[2-[(2,6-dimethylquinolin-4-yl)amino]ethylamino]-7-fluoro-2-methyl-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-10-one |
|---|---|
| PubChem CID | 143541610 |
| Molecular Formula | C27H28FN5O3 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 11-acetyl-8-amino-6-[2-[(2,6-dimethylquinolin-4-yl)amino]ethylamino]-7-fluoro-2-methyl-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-10-one |
| SMILES | CC(=O)c1cn2c3c(c(NCCNc4cc(C)nc5ccc(C)cc45)c(F)c(N)c3c1=O)OCC2C |
| InChI | InChI=1S/C27H28FN5O3/c1-13-5-6-19-17(9-13)20(10-14(2)32-19)30-7-8-31-24-22(28)23(29)21-25-27(24)36-12-15(3)33(25)11-18(16(4)34)26(21)35/h5-6,9-11,15,31H,7-8,12,29H2,1-4H3,(H,30,32) |
| InChIKey | BKNJNEXEOUFDGU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|