C18H19FN6O4S — CID 59002826
(2S)-8-amino-7-fluoro-2-methyl-6-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethylamino]-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid (PubChem CID 59002826) has the molecular formula C18H19FN6O4S and a molecular weight of 434.45 g/mol. Its IUPAC name is (2S)-8-amino-7-fluoro-2-methyl-6-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethylamino]-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid.
| Compound Name | (2S)-8-amino-7-fluoro-2-methyl-6-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethylamino]-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
|---|---|
| PubChem CID | 59002826 |
| Molecular Formula | C18H19FN6O4S |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | (2S)-8-amino-7-fluoro-2-methyl-6-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethylamino]-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
| SMILES | Cc1nc(SCCNc2c(F)c(N)c3c(=O)c(C(=O)O)cn4c3c2OC[C@@H]4C)n[nH]1 |
| InChI | InChI=1S/C18H19FN6O4S/c1-7-6-29-16-13(21-3-4-30-18-22-8(2)23-24-18)11(19)12(20)10-14(16)25(7)5-9(15(10)26)17(27)28/h5,7,21H,3-4,6,20H2,1-2H3,(H,27,28)(H,22,23,24)/t7-/m0/s1 |
| InChIKey | MVKBVCRYBGSJCW-ZETCQYMHSA-N |
| XLogP | 2.01 |
| TPSA | 148.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|