C20H18N4O — CID 142836328
6-amino-N-cyclopropyl-5-(naphthalene-2-carboximidoyl)pyridine-3-carboxamide (PubChem CID 142836328) has the molecular formula C20H18N4O and a molecular weight of 330.39 g/mol. Its IUPAC name is 6-amino-N-cyclopropyl-5-(naphthalene-2-carboximidoyl)pyridine-3-carboxamide.
| Compound Name | 6-amino-N-cyclopropyl-5-(naphthalene-2-carboximidoyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142836328 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 6-amino-N-cyclopropyl-5-(naphthalene-2-carboximidoyl)pyridine-3-carboxamide |
| SMILES | [H]/N=C(\c1ccc2ccccc2c1)c1cc(C(=O)NC2CC2)cnc1N |
| InChI | InChI=1S/C20H18N4O/c21-18(14-6-5-12-3-1-2-4-13(12)9-14)17-10-15(11-23-19(17)22)20(25)24-16-7-8-16/h1-6,9-11,16,21H,7-8H2,(H2,22,23)(H,24,25)/b21-18+ |
| InChIKey | UTDWMMJMEGCRMS-DYTRJAOYSA-N |
| XLogP | 3.13 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|