C18H20N4O3 — CID 154737484
N-[4-(carbamoylcarbamoyl)cyclohexyl]quinoline-3-carboxamide (PubChem CID 154737484) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-[4-(carbamoylcarbamoyl)cyclohexyl]quinoline-3-carboxamide.
| Compound Name | N-[4-(carbamoylcarbamoyl)cyclohexyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 154737484 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-[4-(carbamoylcarbamoyl)cyclohexyl]quinoline-3-carboxamide |
| SMILES | NC(=O)NC(=O)C1CCC(NC(=O)c2cnc3ccccc3c2)CC1 |
| InChI | InChI=1S/C18H20N4O3/c19-18(25)22-16(23)11-5-7-14(8-6-11)21-17(24)13-9-12-3-1-2-4-15(12)20-10-13/h1-4,9-11,14H,5-8H2,(H,21,24)(H3,19,22,23,25) |
| InChIKey | XPBRBVCHPHPPLB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |