C19H23F2N3O — CID 150149024
N-[4-[[(2S)-1,1-difluoropropan-2-yl]amino]cyclohexyl]quinoline-3-carboxamide (PubChem CID 150149024) has the molecular formula C19H23F2N3O and a molecular weight of 347.41 g/mol. Its IUPAC name is N-[4-[[(2S)-1,1-difluoropropan-2-yl]amino]cyclohexyl]quinoline-3-carboxamide.
| Compound Name | N-[4-[[(2S)-1,1-difluoropropan-2-yl]amino]cyclohexyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 150149024 |
| Molecular Formula | C19H23F2N3O |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-[4-[[(2S)-1,1-difluoropropan-2-yl]amino]cyclohexyl]quinoline-3-carboxamide |
| SMILES | C[C@H](NC1CCC(NC(=O)c2cnc3ccccc3c2)CC1)C(F)F |
| InChI | InChI=1S/C19H23F2N3O/c1-12(18(20)21)23-15-6-8-16(9-7-15)24-19(25)14-10-13-4-2-3-5-17(13)22-11-14/h2-5,10-12,15-16,18,23H,6-9H2,1H3,(H,24,25)/t12-,15?,16?/m0/s1 |
| InChIKey | FEWDCPVZDSAOAS-JQRITLKVSA-N |
| XLogP | 3.52 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |