C20H24F2N2O4 — CID 129247348
7-(difluoromethoxy)-N-[4-(2-hydroxypropoxy)cyclohexyl]quinoline-3-carboxamide (PubChem CID 129247348) has the molecular formula C20H24F2N2O4 and a molecular weight of 394.42 g/mol. Its IUPAC name is 7-(difluoromethoxy)-N-[4-(2-hydroxypropoxy)cyclohexyl]quinoline-3-carboxamide.
| Compound Name | 7-(difluoromethoxy)-N-[4-(2-hydroxypropoxy)cyclohexyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 129247348 |
| Molecular Formula | C20H24F2N2O4 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 7-(difluoromethoxy)-N-[4-(2-hydroxypropoxy)cyclohexyl]quinoline-3-carboxamide |
| SMILES | CC(O)COC1CCC(NC(=O)c2cnc3cc(OC(F)F)ccc3c2)CC1 |
| InChI | InChI=1S/C20H24F2N2O4/c1-12(25)11-27-16-6-3-15(4-7-16)24-19(26)14-8-13-2-5-17(28-20(21)22)9-18(13)23-10-14/h2,5,8-10,12,15-16,20,25H,3-4,6-7,11H2,1H3,(H,24,26) |
| InChIKey | PUUCLSOESVOWQV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |