C21H28N2O4 — CID 129247320
N-[4-(2-hydroxy-2-methylpropoxy)cyclohexyl]-7-methoxyquinoline-3-carboxamide (PubChem CID 129247320) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-[4-(2-hydroxy-2-methylpropoxy)cyclohexyl]-7-methoxyquinoline-3-carboxamide.
| Compound Name | N-[4-(2-hydroxy-2-methylpropoxy)cyclohexyl]-7-methoxyquinoline-3-carboxamide |
|---|---|
| PubChem CID | 129247320 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-[4-(2-hydroxy-2-methylpropoxy)cyclohexyl]-7-methoxyquinoline-3-carboxamide |
| SMILES | COc1ccc2cc(C(=O)NC3CCC(OCC(C)(C)O)CC3)cnc2c1 |
| InChI | InChI=1S/C21H28N2O4/c1-21(2,25)13-27-17-8-5-16(6-9-17)23-20(24)15-10-14-4-7-18(26-3)11-19(14)22-12-15/h4,7,10-12,16-17,25H,5-6,8-9,13H2,1-3H3,(H,23,24) |
| InChIKey | HDBXBTLLEWPGJW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |