C18H18F5IN2O3 — CID 163900375
7-(difluoromethoxy)-N-[4-[hydroxy(trifluoromethyl)-λ3-iodanyl]cyclohexyl]quinoline-3-carboxamide (PubChem CID 163900375) has the molecular formula C18H18F5IN2O3 and a molecular weight of 532.25 g/mol. Its IUPAC name is 7-(difluoromethoxy)-N-[4-[hydroxy(trifluoromethyl)-λ3-iodanyl]cyclohexyl]quinoline-3-carboxamide.
| Compound Name | 7-(difluoromethoxy)-N-[4-[hydroxy(trifluoromethyl)-λ3-iodanyl]cyclohexyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 163900375 |
| Molecular Formula | C18H18F5IN2O3 |
| Molecular Weight | 532.25 g/mol |
| Exact Mass | 532.03 |
| IUPAC Name | 7-(difluoromethoxy)-N-[4-[hydroxy(trifluoromethyl)-λ3-iodanyl]cyclohexyl]quinoline-3-carboxamide |
| SMILES | O=C(NC1CCC(I(O)C(F)(F)F)CC1)c1cnc2cc(OC(F)F)ccc2c1 |
| InChI | InChI=1S/C18H18F5IN2O3/c19-17(20)29-14-6-1-10-7-11(9-25-15(10)8-14)16(27)26-13-4-2-12(3-5-13)24(28)18(21,22)23/h1,6-9,12-13,17,28H,2-5H2,(H,26,27) |
| InChIKey | QJHXRTKQJAJAHZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.25 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|