C19H22ClF2N3O3 — CID 129247358
4-[[6-chloro-7-(difluoromethoxy)quinoline-3-carbonyl]amino]-N,N-dimethylcyclohexan-1-amine oxide (PubChem CID 129247358) has the molecular formula C19H22ClF2N3O3 and a molecular weight of 413.85 g/mol. Its IUPAC name is 4-[[6-chloro-7-(difluoromethoxy)quinoline-3-carbonyl]amino]-N,N-dimethylcyclohexan-1-amine oxide.
| Compound Name | 4-[[6-chloro-7-(difluoromethoxy)quinoline-3-carbonyl]amino]-N,N-dimethylcyclohexan-1-amine oxide |
|---|---|
| PubChem CID | 129247358 |
| Molecular Formula | C19H22ClF2N3O3 |
| Molecular Weight | 413.85 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 4-[[6-chloro-7-(difluoromethoxy)quinoline-3-carbonyl]amino]-N,N-dimethylcyclohexan-1-amine oxide |
| SMILES | C[N+](C)([O-])C1CCC(NC(=O)c2cnc3cc(OC(F)F)c(Cl)cc3c2)CC1 |
| InChI | InChI=1S/C19H22ClF2N3O3/c1-25(2,27)14-5-3-13(4-6-14)24-18(26)12-7-11-8-15(20)17(28-19(21)22)9-16(11)23-10-12/h7-10,13-14,19H,3-6H2,1-2H3,(H,24,26) |
| InChIKey | PQZBIRFWVWMEOF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 74.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.85 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|