C18H24ClN7O2 — CID 129276284
N-[1-[(Z)-N-amino-N-methylcarbamohydrazonoyl]piperidin-4-yl]-6-chloro-7-methoxyquinoline-3-carboxamide (PubChem CID 129276284) has the molecular formula C18H24ClN7O2 and a molecular weight of 405.89 g/mol. Its IUPAC name is N-[1-[(Z)-N-amino-N-methylcarbamohydrazonoyl]piperidin-4-yl]-6-chloro-7-methoxyquinoline-3-carboxamide.
| Compound Name | N-[1-[(Z)-N-amino-N-methylcarbamohydrazonoyl]piperidin-4-yl]-6-chloro-7-methoxyquinoline-3-carboxamide |
|---|---|
| PubChem CID | 129276284 |
| Molecular Formula | C18H24ClN7O2 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N-[1-[(Z)-N-amino-N-methylcarbamohydrazonoyl]piperidin-4-yl]-6-chloro-7-methoxyquinoline-3-carboxamide |
| SMILES | COc1cc2ncc(C(=O)NC3CCN(/C(=N/N)N(C)N)CC3)cc2cc1Cl |
| InChI | InChI=1S/C18H24ClN7O2/c1-25(21)18(24-20)26-5-3-13(4-6-26)23-17(27)12-7-11-8-14(19)16(28-2)9-15(11)22-10-12/h7-10,13H,3-6,20-21H2,1-2H3,(H,23,27)/b24-18+ |
| InChIKey | YSKJBGGOZQBYMO-HKOYGPOVSA-N |
| XLogP | 1.13 |
| TPSA | 122.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|