C17H18BrN5O3 — CID 169102861
6-bromo-N-[1-(2-hydrazinyl-2-oxoacetyl)piperidin-4-yl]quinoline-3-carboxamide (PubChem CID 169102861) has the molecular formula C17H18BrN5O3 and a molecular weight of 420.27 g/mol. Its IUPAC name is 6-bromo-N-[1-(2-hydrazinyl-2-oxoacetyl)piperidin-4-yl]quinoline-3-carboxamide.
| Compound Name | 6-bromo-N-[1-(2-hydrazinyl-2-oxoacetyl)piperidin-4-yl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 169102861 |
| Molecular Formula | C17H18BrN5O3 |
| Molecular Weight | 420.27 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 6-bromo-N-[1-(2-hydrazinyl-2-oxoacetyl)piperidin-4-yl]quinoline-3-carboxamide |
| SMILES | NNC(=O)C(=O)N1CCC(NC(=O)c2cnc3ccc(Br)cc3c2)CC1 |
| InChI | InChI=1S/C17H18BrN5O3/c18-12-1-2-14-10(8-12)7-11(9-20-14)15(24)21-13-3-5-23(6-4-13)17(26)16(25)22-19/h1-2,7-9,13H,3-6,19H2,(H,21,24)(H,22,25) |
| InChIKey | UVDXDPKQVHBZGW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|