C18H25N7O2 — CID 129276277
N-[1-[(Z)-N-amino-N-methylcarbamohydrazonoyl]piperidin-4-yl]-7-methoxyquinoline-3-carboxamide (PubChem CID 129276277) has the molecular formula C18H25N7O2 and a molecular weight of 371.45 g/mol. Its IUPAC name is N-[1-[(Z)-N-amino-N-methylcarbamohydrazonoyl]piperidin-4-yl]-7-methoxyquinoline-3-carboxamide.
| Compound Name | N-[1-[(Z)-N-amino-N-methylcarbamohydrazonoyl]piperidin-4-yl]-7-methoxyquinoline-3-carboxamide |
|---|---|
| PubChem CID | 129276277 |
| Molecular Formula | C18H25N7O2 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | N-[1-[(Z)-N-amino-N-methylcarbamohydrazonoyl]piperidin-4-yl]-7-methoxyquinoline-3-carboxamide |
| SMILES | COc1ccc2cc(C(=O)NC3CCN(/C(=N/N)N(C)N)CC3)cnc2c1 |
| InChI | InChI=1S/C18H25N7O2/c1-24(20)18(23-19)25-7-5-14(6-8-25)22-17(26)13-9-12-3-4-15(27-2)10-16(12)21-11-13/h3-4,9-11,14H,5-8,19-20H2,1-2H3,(H,22,26)/b23-18+ |
| InChIKey | JXPMRXITTKSARP-PTGBLXJZSA-N |
| XLogP | 0.47 |
| TPSA | 122.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|