C18H25F2N7O2 — CID 145333175
7-(difluoromethoxy)-N-[1-(N-hydrazinyl-N-methylcarbamimidoyl)piperidin-4-yl]quinoline-3-carboxamide;molecular hydrogen (PubChem CID 145333175) has the molecular formula C18H25F2N7O2 and a molecular weight of 409.44 g/mol. Its IUPAC name is 7-(difluoromethoxy)-N-[1-(N-hydrazinyl-N-methylcarbamimidoyl)piperidin-4-yl]quinoline-3-carboxamide;molecular hydrogen.
| Compound Name | 7-(difluoromethoxy)-N-[1-(N-hydrazinyl-N-methylcarbamimidoyl)piperidin-4-yl]quinoline-3-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 145333175 |
| Molecular Formula | C18H25F2N7O2 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 7-(difluoromethoxy)-N-[1-(N-hydrazinyl-N-methylcarbamimidoyl)piperidin-4-yl]quinoline-3-carboxamide;molecular hydrogen |
| SMILES | [H]/N=C(/N1CCC(NC(=O)c2cnc3cc(OC(F)F)ccc3c2)CC1)N(C)NN.[H][H] |
| InChI | InChI=1S/C18H23F2N7O2.H2/c1-26(25-22)18(21)27-6-4-13(5-7-27)24-16(28)12-8-11-2-3-14(29-17(19)20)9-15(11)23-10-12;/h2-3,8-10,13,17,21,25H,4-7,22H2,1H3,(H,24,28);1H/b21-18+; |
| InChIKey | BLSRTXPYMCKGES-GOSREXKOSA-N |
| XLogP | 1.52 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|