C13H13ClF2N2O2 — CID 145333231
6-chloro-7-(difluoromethoxy)quinoline-3-carboxamide;ethane (PubChem CID 145333231) has the molecular formula C13H13ClF2N2O2 and a molecular weight of 302.71 g/mol. Its IUPAC name is 6-chloro-7-(difluoromethoxy)quinoline-3-carboxamide;ethane.
| Compound Name | 6-chloro-7-(difluoromethoxy)quinoline-3-carboxamide;ethane |
|---|---|
| PubChem CID | 145333231 |
| Molecular Formula | C13H13ClF2N2O2 |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 6-chloro-7-(difluoromethoxy)quinoline-3-carboxamide;ethane |
| SMILES | CC.NC(=O)c1cnc2cc(OC(F)F)c(Cl)cc2c1 |
| InChI | InChI=1S/C11H7ClF2N2O2.C2H6/c12-7-2-5-1-6(10(15)17)4-16-8(5)3-9(7)18-11(13)14;1-2/h1-4,11H,(H2,15,17);1-2H3 |
| InChIKey | LZXNPIWFWBDTBX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |