C22H27N5O3 — CID 176790912
N-[4-[(2R)-2-hydroxypropoxy]cyclohexyl]-2-(3-methylindazol-1-yl)pyrimidine-5-carboxamide (PubChem CID 176790912) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is N-[4-[(2R)-2-hydroxypropoxy]cyclohexyl]-2-(3-methylindazol-1-yl)pyrimidine-5-carboxamide.
| Compound Name | N-[4-[(2R)-2-hydroxypropoxy]cyclohexyl]-2-(3-methylindazol-1-yl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 176790912 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | N-[4-[(2R)-2-hydroxypropoxy]cyclohexyl]-2-(3-methylindazol-1-yl)pyrimidine-5-carboxamide |
| SMILES | Cc1nn(-c2ncc(C(=O)NC3CCC(OC[C@@H](C)O)CC3)cn2)c2ccccc12 |
| InChI | InChI=1S/C22H27N5O3/c1-14(28)13-30-18-9-7-17(8-10-18)25-21(29)16-11-23-22(24-12-16)27-20-6-4-3-5-19(20)15(2)26-27/h3-6,11-12,14,17-18,28H,7-10,13H2,1-2H3,(H,25,29)/t14-,17?,18?/m1/s1 |
| InChIKey | RCGQWDFRPUUMDA-RWBZWWBESA-N |
| XLogP | 2.56 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |