C22H27N5O3S — CID 176790881
2-(3-methylindazol-1-yl)-N-[4-(2-methylsulfonylethyl)cyclohexyl]pyrimidine-5-carboxamide (PubChem CID 176790881) has the molecular formula C22H27N5O3S and a molecular weight of 441.56 g/mol. Its IUPAC name is 2-(3-methylindazol-1-yl)-N-[4-(2-methylsulfonylethyl)cyclohexyl]pyrimidine-5-carboxamide.
| Compound Name | 2-(3-methylindazol-1-yl)-N-[4-(2-methylsulfonylethyl)cyclohexyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 176790881 |
| Molecular Formula | C22H27N5O3S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 2-(3-methylindazol-1-yl)-N-[4-(2-methylsulfonylethyl)cyclohexyl]pyrimidine-5-carboxamide |
| SMILES | Cc1nn(-c2ncc(C(=O)NC3CCC(CCS(C)(=O)=O)CC3)cn2)c2ccccc12 |
| InChI | InChI=1S/C22H27N5O3S/c1-15-19-5-3-4-6-20(19)27(26-15)22-23-13-17(14-24-22)21(28)25-18-9-7-16(8-10-18)11-12-31(2,29)30/h3-6,13-14,16,18H,7-12H2,1-2H3,(H,25,28) |
| InChIKey | KJGDIYKZDSYJIB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |