C19H21ClN2O — CID 142837982
(Z)-3-(4-chlorophenyl)-1-(3-methoxyphenyl)-N,N-dimethyl-3-methyliminoprop-1-en-1-amine (PubChem CID 142837982) has the molecular formula C19H21ClN2O and a molecular weight of 328.84 g/mol. Its IUPAC name is (Z)-3-(4-chlorophenyl)-1-(3-methoxyphenyl)-N,N-dimethyl-3-methyliminoprop-1-en-1-amine.
| Compound Name | (Z)-3-(4-chlorophenyl)-1-(3-methoxyphenyl)-N,N-dimethyl-3-methyliminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 142837982 |
| Molecular Formula | C19H21ClN2O |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (Z)-3-(4-chlorophenyl)-1-(3-methoxyphenyl)-N,N-dimethyl-3-methyliminoprop-1-en-1-amine |
| SMILES | C/N=C(/C=C(/c1cccc(OC)c1)N(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21ClN2O/c1-21-18(14-8-10-16(20)11-9-14)13-19(22(2)3)15-6-5-7-17(12-15)23-4/h5-13H,1-4H3/b19-13-,21-18- |
| InChIKey | BWPOTGJVFYXTDF-QSIFSKDASA-N |
| XLogP | 4.37 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|