C24H37F2NO3 — CID 142838466
propan-2-yl 7-[2-[(1E,6Z,8Z)-4,4-difluorodeca-1,6,8-trienyl]-5-oxopyrrolidin-1-yl]heptanoate (PubChem CID 142838466) has the molecular formula C24H37F2NO3 and a molecular weight of 425.56 g/mol. Its IUPAC name is propan-2-yl 7-[2-[(1E,6Z,8Z)-4,4-difluorodeca-1,6,8-trienyl]-5-oxopyrrolidin-1-yl]heptanoate.
| Compound Name | propan-2-yl 7-[2-[(1E,6Z,8Z)-4,4-difluorodeca-1,6,8-trienyl]-5-oxopyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 142838466 |
| Molecular Formula | C24H37F2NO3 |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | propan-2-yl 7-[2-[(1E,6Z,8Z)-4,4-difluorodeca-1,6,8-trienyl]-5-oxopyrrolidin-1-yl]heptanoate |
| SMILES | C/C=C\C=C/CC(F)(F)C/C=C/C1CCC(=O)N1CCCCCCC(=O)OC(C)C |
| InChI | InChI=1S/C24H37F2NO3/c1-4-5-6-10-17-24(25,26)18-12-13-21-15-16-22(28)27(21)19-11-8-7-9-14-23(29)30-20(2)3/h4-6,10,12-13,20-21H,7-9,11,14-19H2,1-3H3/b5-4-,10-6-,13-12+ |
| InChIKey | PQDLJGSCGPULFG-SQZHZZOSSA-N |
| XLogP | 5.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|