C12H18N2O2 — CID 142839862
2-(2-carbamoyl-5-methylphenyl)-N,N-dimethylethanamine oxide (PubChem CID 142839862) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-(2-carbamoyl-5-methylphenyl)-N,N-dimethylethanamine oxide.
| Compound Name | 2-(2-carbamoyl-5-methylphenyl)-N,N-dimethylethanamine oxide |
|---|---|
| PubChem CID | 142839862 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-(2-carbamoyl-5-methylphenyl)-N,N-dimethylethanamine oxide |
| SMILES | Cc1ccc(C(N)=O)c(CC[N+](C)(C)[O-])c1 |
| InChI | InChI=1S/C12H18N2O2/c1-9-4-5-11(12(13)15)10(8-9)6-7-14(2,3)16/h4-5,8H,6-7H2,1-3H3,(H2,13,15) |
| InChIKey | AFNGDLAQWVKZJJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|