C11H17NO — CID 86057994
N,N-dimethyl-2-(4-methylphenyl)ethanamine oxide (PubChem CID 86057994) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is N,N-dimethyl-2-(4-methylphenyl)ethanamine oxide.
| Compound Name | N,N-dimethyl-2-(4-methylphenyl)ethanamine oxide |
|---|---|
| PubChem CID | 86057994 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N,N-dimethyl-2-(4-methylphenyl)ethanamine oxide |
| SMILES | Cc1ccc(CC[N+](C)(C)[O-])cc1 |
| InChI | InChI=1S/C11H17NO/c1-10-4-6-11(7-5-10)8-9-12(2,3)13/h4-7H,8-9H2,1-3H3 |
| InChIKey | OISHLHFEFDLYEH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|