C10H15NO2 — CID 11344368
1-(2-hydroxy-5-methylphenyl)-N,N-dimethylmethanamine oxide (PubChem CID 11344368) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 1-(2-hydroxy-5-methylphenyl)-N,N-dimethylmethanamine oxide.
| Compound Name | 1-(2-hydroxy-5-methylphenyl)-N,N-dimethylmethanamine oxide |
|---|---|
| PubChem CID | 11344368 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 1-(2-hydroxy-5-methylphenyl)-N,N-dimethylmethanamine oxide |
| SMILES | Cc1ccc(O)c(C[N+](C)(C)[O-])c1 |
| InChI | InChI=1S/C10H15NO2/c1-8-4-5-10(12)9(6-8)7-11(2,3)13/h4-6,12H,7H2,1-3H3 |
| InChIKey | SHTAQOPZNMNQRW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|