C15H22N4O3S — CID 142840304
1-[3-amino-2-(1-amino-1-hydroxyethyl)-4-(hydroxymethyl)thieno[2,3-b]pyridin-6-yl]piperidin-4-ol (PubChem CID 142840304) has the molecular formula C15H22N4O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is 1-[3-amino-2-(1-amino-1-hydroxyethyl)-4-(hydroxymethyl)thieno[2,3-b]pyridin-6-yl]piperidin-4-ol.
| Compound Name | 1-[3-amino-2-(1-amino-1-hydroxyethyl)-4-(hydroxymethyl)thieno[2,3-b]pyridin-6-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 142840304 |
| Molecular Formula | C15H22N4O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-[3-amino-2-(1-amino-1-hydroxyethyl)-4-(hydroxymethyl)thieno[2,3-b]pyridin-6-yl]piperidin-4-ol |
| SMILES | CC(N)(O)c1sc2nc(N3CCC(O)CC3)cc(CO)c2c1N |
| InChI | InChI=1S/C15H22N4O3S/c1-15(17,22)13-12(16)11-8(7-20)6-10(18-14(11)23-13)19-4-2-9(21)3-5-19/h6,9,20-22H,2-5,7,16-17H2,1H3 |
| InChIKey | SONHFINNLVJXSP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 128.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|