C20H31N5OS — CID 143033503
1-(6-amino-13-propyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)piperidin-4-ol;ethane;methane (PubChem CID 143033503) has the molecular formula C20H31N5OS and a molecular weight of 389.57 g/mol. Its IUPAC name is 1-(6-amino-13-propyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)piperidin-4-ol;ethane;methane.
| Compound Name | 1-(6-amino-13-propyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)piperidin-4-ol;ethane;methane |
|---|---|
| PubChem CID | 143033503 |
| Molecular Formula | C20H31N5OS |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 1-(6-amino-13-propyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)piperidin-4-ol;ethane;methane |
| SMILES | C.CC.CCCc1cc(N2CCC(O)CC2)nc2sc3c(N)ncnc3c12 |
| InChI | InChI=1S/C17H21N5OS.C2H6.CH4/c1-2-3-10-8-12(22-6-4-11(23)5-7-22)21-17-13(10)14-15(24-17)16(18)20-9-19-14;1-2;/h8-9,11,23H,2-7H2,1H3,(H2,18,19,20);1-2H3;1H4 |
| InChIKey | SDNMLEBLBSIYLF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |