C18H24ClN3 — CID 142840617
3-[1-(4-chlorocyclohexa-1,5-dien-1-yl)cyclobutyl]-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine (PubChem CID 142840617) has the molecular formula C18H24ClN3 and a molecular weight of 317.86 g/mol. Its IUPAC name is 3-[1-(4-chlorocyclohexa-1,5-dien-1-yl)cyclobutyl]-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine.
| Compound Name | 3-[1-(4-chlorocyclohexa-1,5-dien-1-yl)cyclobutyl]-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine |
|---|---|
| PubChem CID | 142840617 |
| Molecular Formula | C18H24ClN3 |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 3-[1-(4-chlorocyclohexa-1,5-dien-1-yl)cyclobutyl]-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine |
| SMILES | ClC1C=CC(C2(c3nnc4n3CCCCCC4)CCC2)=CC1 |
| InChI | InChI=1S/C18H24ClN3/c19-15-9-7-14(8-10-15)18(11-5-12-18)17-21-20-16-6-3-1-2-4-13-22(16)17/h7-9,15H,1-6,10-13H2 |
| InChIKey | VKLKPXBTBGFOEN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|