C19H18ClFN3U- — CID 163947383
3-(2-chlorocyclohexa-2,4-dien-1-yl)-5-(3-fluoro-1-phenylcyclobutyl)-4-methyl-1,2,4-triazole;uranium (PubChem CID 163947383) has the molecular formula C19H18ClFN3U- and a molecular weight of 580.85 g/mol. Its IUPAC name is 3-(2-chlorocyclohexa-2,4-dien-1-yl)-5-(3-fluoro-1-phenylcyclobutyl)-4-methyl-1,2,4-triazole;uranium.
| Compound Name | 3-(2-chlorocyclohexa-2,4-dien-1-yl)-5-(3-fluoro-1-phenylcyclobutyl)-4-methyl-1,2,4-triazole;uranium |
|---|---|
| PubChem CID | 163947383 |
| Molecular Formula | C19H18ClFN3U- |
| Molecular Weight | 580.85 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | 3-(2-chlorocyclohexa-2,4-dien-1-yl)-5-(3-fluoro-1-phenylcyclobutyl)-4-methyl-1,2,4-triazole;uranium |
| SMILES | Cn1c(C2CC=CC=C2Cl)nnc1C1(c2cc[c-]cc2)CC(F)C1.[U] |
| InChI | InChI=1S/C19H18ClFN3.U/c1-24-17(15-9-5-6-10-16(15)20)22-23-18(24)19(11-14(21)12-19)13-7-3-2-4-8-13;/h3-8,10,14-15H,9,11-12H2,1H3;/q-1; |
| InChIKey | DOVFYARCIDKFES-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.85 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|