C24H35N3 — CID 143046817
3-(1-cyclohepta-1,3,6-trien-1-ylcyclobutyl)-5-[(E)-3,4-diethylhex-4-en-3-yl]-4-methyl-1,2,4-triazole (PubChem CID 143046817) has the molecular formula C24H35N3 and a molecular weight of 365.57 g/mol. Its IUPAC name is 3-(1-cyclohepta-1,3,6-trien-1-ylcyclobutyl)-5-[(E)-3,4-diethylhex-4-en-3-yl]-4-methyl-1,2,4-triazole.
| Compound Name | 3-(1-cyclohepta-1,3,6-trien-1-ylcyclobutyl)-5-[(E)-3,4-diethylhex-4-en-3-yl]-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 143046817 |
| Molecular Formula | C24H35N3 |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 365.28 |
| IUPAC Name | 3-(1-cyclohepta-1,3,6-trien-1-ylcyclobutyl)-5-[(E)-3,4-diethylhex-4-en-3-yl]-4-methyl-1,2,4-triazole |
| SMILES | C/C=C(\CC)C(CC)(CC)c1nnc(C2(C3=CC=CCC=C3)CCC2)n1C |
| InChI | InChI=1S/C24H35N3/c1-6-19(7-2)23(8-3,9-4)21-25-26-22(27(21)5)24(17-14-18-24)20-15-12-10-11-13-16-20/h6,10,12-13,15-16H,7-9,11,14,17-18H2,1-5H3/b19-6+ |
| InChIKey | DJRBJMMRPDNGDD-KPSZGOFPSA-N |
| XLogP | 6.09 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|