C13H19N3 — CID 143046720
3-[1-[(2E,4Z)-hexa-2,4-dien-2-yl]cyclopropyl]-4,5-dimethyl-1,2,4-triazole (PubChem CID 143046720) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 3-[1-[(2E,4Z)-hexa-2,4-dien-2-yl]cyclopropyl]-4,5-dimethyl-1,2,4-triazole.
| Compound Name | 3-[1-[(2E,4Z)-hexa-2,4-dien-2-yl]cyclopropyl]-4,5-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 143046720 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 3-[1-[(2E,4Z)-hexa-2,4-dien-2-yl]cyclopropyl]-4,5-dimethyl-1,2,4-triazole |
| SMILES | C/C=C\C=C(/C)C1(c2nnc(C)n2C)CC1 |
| InChI | InChI=1S/C13H19N3/c1-5-6-7-10(2)13(8-9-13)12-15-14-11(3)16(12)4/h5-7H,8-9H2,1-4H3/b6-5-,10-7+ |
| InChIKey | BURRJQPEBDFMDX-ZZWPSLBBSA-N |
| XLogP | 2.68 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|