C21H32ClN3 — CID 142840604
(E)-2-chloropent-2-ene;3-(3-methylidene-1-prop-2-enylcyclobutyl)-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine (PubChem CID 142840604) has the molecular formula C21H32ClN3 and a molecular weight of 361.96 g/mol. Its IUPAC name is (E)-2-chloropent-2-ene;3-(3-methylidene-1-prop-2-enylcyclobutyl)-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine.
| Compound Name | (E)-2-chloropent-2-ene;3-(3-methylidene-1-prop-2-enylcyclobutyl)-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine |
|---|---|
| PubChem CID | 142840604 |
| Molecular Formula | C21H32ClN3 |
| Molecular Weight | 361.96 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | (E)-2-chloropent-2-ene;3-(3-methylidene-1-prop-2-enylcyclobutyl)-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine |
| SMILES | C=CCC1(c2nnc3n2CCCCCC3)CC(=C)C1.CC/C=C(\C)Cl |
| InChI | InChI=1S/C16H23N3.C5H9Cl/c1-3-9-16(11-13(2)12-16)15-18-17-14-8-6-4-5-7-10-19(14)15;1-3-4-5(2)6/h3H,1-2,4-12H2;4H,3H2,1-2H3/b;5-4+ |
| InChIKey | LIJSWMVJNPQISJ-RCKHEGBHSA-N |
| XLogP | 6.10 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.96 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|