C23H34F2O — CID 142841172
(3Z)-3-[(2E)-2-[1-(3,3-difluoropropyl)-3a,7a-dimethyl-1,2,3,5,6,7-hexahydroinden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol (PubChem CID 142841172) has the molecular formula C23H34F2O and a molecular weight of 364.52 g/mol. Its IUPAC name is (3Z)-3-[(2E)-2-[1-(3,3-difluoropropyl)-3a,7a-dimethyl-1,2,3,5,6,7-hexahydroinden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol.
| Compound Name | (3Z)-3-[(2E)-2-[1-(3,3-difluoropropyl)-3a,7a-dimethyl-1,2,3,5,6,7-hexahydroinden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 142841172 |
| Molecular Formula | C23H34F2O |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | (3Z)-3-[(2E)-2-[1-(3,3-difluoropropyl)-3a,7a-dimethyl-1,2,3,5,6,7-hexahydroinden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol |
| SMILES | C=C1/C(=C\C=C2/CCCC3(C)C(CCC(F)F)CCC23C)CCCC1O |
| InChI | InChI=1S/C23H34F2O/c1-16-17(6-4-8-20(16)26)9-10-18-7-5-14-22(2)19(11-12-21(24)25)13-15-23(18,22)3/h9-10,19-21,26H,1,4-8,11-15H2,2-3H3/b17-9-,18-10+ |
| InChIKey | IMPINWWRQYXQFD-BUOZRGFLSA-N |
| XLogP | 6.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |