C26H30FN7O2S — CID 142841316
tert-butyl 1-[2-amino-6-(3-fluoro-4-pyridin-4-ylsulfanylanilino)pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate (PubChem CID 142841316) has the molecular formula C26H30FN7O2S and a molecular weight of 523.64 g/mol. Its IUPAC name is tert-butyl 1-[2-amino-6-(3-fluoro-4-pyridin-4-ylsulfanylanilino)pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 1-[2-amino-6-(3-fluoro-4-pyridin-4-ylsulfanylanilino)pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 142841316 |
| Molecular Formula | C26H30FN7O2S |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | tert-butyl 1-[2-amino-6-(3-fluoro-4-pyridin-4-ylsulfanylanilino)pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CCN(c3cc(Nc4ccc(Sc5ccncc5)c(F)c4)nc(N)n3)C2C1 |
| InChI | InChI=1S/C26H30FN7O2S/c1-26(2,3)36-25(35)33-14-16-8-11-34(20(16)15-33)23-13-22(31-24(28)32-23)30-17-4-5-21(19(27)12-17)37-18-6-9-29-10-7-18/h4-7,9-10,12-13,16,20H,8,11,14-15H2,1-3H3,(H3,28,30,31,32) |
| InChIKey | RVYVHHASMFNSEX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |