C9H11NS — CID 142842838
6-methylsulfanyl-7,7a-dihydro-1H-indole (PubChem CID 142842838) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 6-methylsulfanyl-7,7a-dihydro-1H-indole.
| Compound Name | 6-methylsulfanyl-7,7a-dihydro-1H-indole |
|---|---|
| PubChem CID | 142842838 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 6-methylsulfanyl-7,7a-dihydro-1H-indole |
| SMILES | CSC1=CC=C2C=CNC2C1 |
| InChI | InChI=1S/C9H11NS/c1-11-8-3-2-7-4-5-10-9(7)6-8/h2-5,9-10H,6H2,1H3 |
| InChIKey | DXRPJHXNEHEKGG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |