C13H24N2 — CID 142843948
ethane;2-[(3E)-penta-1,3-dien-3-yl]-4,5-dihydro-1H-imidazole;prop-1-ene (PubChem CID 142843948) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is ethane;2-[(3E)-penta-1,3-dien-3-yl]-4,5-dihydro-1H-imidazole;prop-1-ene.
| Compound Name | ethane;2-[(3E)-penta-1,3-dien-3-yl]-4,5-dihydro-1H-imidazole;prop-1-ene |
|---|---|
| PubChem CID | 142843948 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | ethane;2-[(3E)-penta-1,3-dien-3-yl]-4,5-dihydro-1H-imidazole;prop-1-ene |
| SMILES | C=C/C(=C\C)C1=NCCN1.C=CC.CC |
| InChI | InChI=1S/C8H12N2.C3H6.C2H6/c1-3-7(4-2)8-9-5-6-10-8;1-3-2;1-2/h3-4H,1,5-6H2,2H3,(H,9,10);3H,1H2,2H3;1-2H3/b7-4+;; |
| InChIKey | OSCUANCGXQLCNZ-RDRKJGRWSA-N |
| XLogP | 3.34 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|