About ethane;[4-methylidene-3-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexan-2-yl]oxyphosphane
ethane;[4-methylidene-3-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexan-2-yl]oxyphosphane (PubChem CID 142844088) has the molecular formula C16H23O3P
and a molecular weight of 294.33 g/mol. Its IUPAC name is ethane;[4-methylidene-3-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexan-2-yl]oxyphosphane.
Molecular Properties
| Compound Name | ethane;[4-methylidene-3-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexan-2-yl]oxyphosphane |
| PubChem CID | 142844088 |
| Molecular Formula | C16H23O3P |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | ethane;[4-methylidene-3-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexan-2-yl]oxyphosphane |
| SMILES | C=C1C(COCc2ccccc2)C(OP)C2OC12.CC |
| InChI | InChI=1S/C14H17O3P.C2H6/c1-9-11(13(17-18)14-12(9)16-14)8-15-7-10-5-3-2-4-6-10;1-2/h2-6,11-14H,1,7-8,18H2;1-2H3 |
| InChIKey | MEOKJLOEZDZHCH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethane;[4-methylidene-3-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexan-2-yl]oxyphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[4-methylidene-3-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexan-2-yl]oxyphosphane?
The IUPAC name of ethane;[4-methylidene-3-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexan-2-yl]oxyphosphane (CID 142844088) is ethane;[4-methylidene-3-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexan-2-yl]oxyphosphane.
What is the SMILES notation for ethane;[4-methylidene-3-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexan-2-yl]oxyphosphane?
The canonical SMILES for ethane;[4-methylidene-3-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexan-2-yl]oxyphosphane is C=C1C(COCc2ccccc2)C(OP)C2OC12.CC.
What is the InChIKey of ethane;[4-methylidene-3-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexan-2-yl]oxyphosphane?
The InChIKey is MEOKJLOEZDZHCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17O3P.C2H6/c1-9-11(13(17-18)14-12(9)16-14)8-15-7-10-5-3-2-4-6-10;1-2/h2-6,11-14H,1,7-8,18H2;1-2H3.
What are the key properties of ethane;[4-methylidene-3-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexan-2-yl]oxyphosphane?
ethane;[4-methylidene-3-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexan-2-yl]oxyphosphane has a molecular weight of 294.33 g/mol, XLogP of 3.36, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[4-methylidene-3-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexan-2-yl]oxyphosphane is sourced from PubChem (CID 142844088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).