C30H31NO4 — CID 142844199
2-[4-[3-(6-tert-butylquinolin-8-yl)phenyl]phenyl]propanoic acid;formaldehyde (PubChem CID 142844199) has the molecular formula C30H31NO4 and a molecular weight of 469.58 g/mol. Its IUPAC name is 2-[4-[3-(6-tert-butylquinolin-8-yl)phenyl]phenyl]propanoic acid;formaldehyde.
| Compound Name | 2-[4-[3-(6-tert-butylquinolin-8-yl)phenyl]phenyl]propanoic acid;formaldehyde |
|---|---|
| PubChem CID | 142844199 |
| Molecular Formula | C30H31NO4 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 2-[4-[3-(6-tert-butylquinolin-8-yl)phenyl]phenyl]propanoic acid;formaldehyde |
| SMILES | C=O.C=O.CC(C(=O)O)c1ccc(-c2cccc(-c3cc(C(C)(C)C)cc4cccnc34)c2)cc1 |
| InChI | InChI=1S/C28H27NO2.2CH2O/c1-18(27(30)31)19-10-12-20(13-11-19)21-7-5-8-22(15-21)25-17-24(28(2,3)4)16-23-9-6-14-29-26(23)25;2*1-2/h5-18H,1-4H3,(H,30,31);2*1H2 |
| InChIKey | IHZFLNHXKIVQCD-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |