C28H29N3O5S — CID 69373625
[5-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]-1-oxidopyridin-1-ium-2-yl] N-propan-2-ylcarbamate (PubChem CID 69373625) has the molecular formula C28H29N3O5S and a molecular weight of 519.62 g/mol. Its IUPAC name is [5-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]-1-oxidopyridin-1-ium-2-yl] N-propan-2-ylcarbamate.
| Compound Name | [5-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]-1-oxidopyridin-1-ium-2-yl] N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 69373625 |
| Molecular Formula | C28H29N3O5S |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | [5-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]-1-oxidopyridin-1-ium-2-yl] N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)Oc1ccc(-c2cccc(-c3cc(C(C)(C)S(C)(=O)=O)cc4cccnc34)c2)c[n+]1[O-] |
| InChI | InChI=1S/C28H29N3O5S/c1-18(2)30-27(32)36-25-12-11-22(17-31(25)33)19-8-6-9-20(14-19)24-16-23(28(3,4)37(5,34)35)15-21-10-7-13-29-26(21)24/h6-18H,1-5H3,(H,30,32) |
| InChIKey | GZSUVIOVEOJDID-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|