C28H24N2O3S — CID 11754393
6-(2-methylsulfonylpropan-2-yl)-8-[3-(1-oxidoquinolin-1-ium-3-yl)phenyl]quinoline (PubChem CID 11754393) has the molecular formula C28H24N2O3S and a molecular weight of 468.58 g/mol. Its IUPAC name is 6-(2-methylsulfonylpropan-2-yl)-8-[3-(1-oxidoquinolin-1-ium-3-yl)phenyl]quinoline.
| Compound Name | 6-(2-methylsulfonylpropan-2-yl)-8-[3-(1-oxidoquinolin-1-ium-3-yl)phenyl]quinoline |
|---|---|
| PubChem CID | 11754393 |
| Molecular Formula | C28H24N2O3S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 6-(2-methylsulfonylpropan-2-yl)-8-[3-(1-oxidoquinolin-1-ium-3-yl)phenyl]quinoline |
| SMILES | CC(C)(c1cc(-c2cccc(-c3cc4ccccc4[n+]([O-])c3)c2)c2ncccc2c1)S(C)(=O)=O |
| InChI | InChI=1S/C28H24N2O3S/c1-28(2,34(3,32)33)24-16-22-11-7-13-29-27(22)25(17-24)20-10-6-9-19(14-20)23-15-21-8-4-5-12-26(21)30(31)18-23/h4-18H,1-3H3 |
| InChIKey | YXKCKNRXMGQDOW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 73.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|