C25H22N6O2S — CID 68958878
6-(2-methylsulfonylpropan-2-yl)-8-[3-[5-(2H-tetrazol-5-yl)-3-pyridinyl]phenyl]quinoline (PubChem CID 68958878) has the molecular formula C25H22N6O2S and a molecular weight of 470.56 g/mol. Its IUPAC name is 6-(2-methylsulfonylpropan-2-yl)-8-[3-[5-(2H-tetrazol-5-yl)-3-pyridinyl]phenyl]quinoline.
| Compound Name | 6-(2-methylsulfonylpropan-2-yl)-8-[3-[5-(2H-tetrazol-5-yl)-3-pyridinyl]phenyl]quinoline |
|---|---|
| PubChem CID | 68958878 |
| Molecular Formula | C25H22N6O2S |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 6-(2-methylsulfonylpropan-2-yl)-8-[3-[5-(2H-tetrazol-5-yl)-3-pyridinyl]phenyl]quinoline |
| SMILES | CC(C)(c1cc(-c2cccc(-c3cncc(-c4nn[nH]n4)c3)c2)c2ncccc2c1)S(C)(=O)=O |
| InChI | InChI=1S/C25H22N6O2S/c1-25(2,34(3,32)33)21-12-18-8-5-9-27-23(18)22(13-21)17-7-4-6-16(10-17)19-11-20(15-26-14-19)24-28-30-31-29-24/h4-15H,1-3H3,(H,28,29,30,31) |
| InChIKey | ZHLQGZDRDIYLCR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |