C28H27NO4S2 — CID 22083698
8-[3-[(E)-2-(4-methylsulfonylphenyl)ethenyl]phenyl]-6-(2-methylsulfonylpropan-2-yl)quinoline (PubChem CID 22083698) has the molecular formula C28H27NO4S2 and a molecular weight of 505.66 g/mol. Its IUPAC name is 8-[3-[(E)-2-(4-methylsulfonylphenyl)ethenyl]phenyl]-6-(2-methylsulfonylpropan-2-yl)quinoline.
| Compound Name | 8-[3-[(E)-2-(4-methylsulfonylphenyl)ethenyl]phenyl]-6-(2-methylsulfonylpropan-2-yl)quinoline |
|---|---|
| PubChem CID | 22083698 |
| Molecular Formula | C28H27NO4S2 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | 8-[3-[(E)-2-(4-methylsulfonylphenyl)ethenyl]phenyl]-6-(2-methylsulfonylpropan-2-yl)quinoline |
| SMILES | CC(C)(c1cc(-c2cccc(/C=C/c3ccc(S(C)(=O)=O)cc3)c2)c2ncccc2c1)S(C)(=O)=O |
| InChI | InChI=1S/C28H27NO4S2/c1-28(2,35(4,32)33)24-18-23-9-6-16-29-27(23)26(19-24)22-8-5-7-21(17-22)11-10-20-12-14-25(15-13-20)34(3,30)31/h5-19H,1-4H3/b11-10+ |
| InChIKey | LYPUWEHVNYRAIG-ZHACJKMWSA-N |
| XLogP | 5.76 |
| TPSA | 81.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|