C33H36N2O5S2 — CID 10121561
(E)-N-tert-butyl-2-(4-methylsulfonylphenyl)-3-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]prop-2-enamide (PubChem CID 10121561) has the molecular formula C33H36N2O5S2 and a molecular weight of 604.79 g/mol. Its IUPAC name is (E)-N-tert-butyl-2-(4-methylsulfonylphenyl)-3-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-tert-butyl-2-(4-methylsulfonylphenyl)-3-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 10121561 |
| Molecular Formula | C33H36N2O5S2 |
| Molecular Weight | 604.79 g/mol |
| Exact Mass | 604.21 |
| IUPAC Name | (E)-N-tert-butyl-2-(4-methylsulfonylphenyl)-3-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]prop-2-enamide |
| SMILES | CC(C)(C)NC(=O)/C(=C/c1cccc(-c2cc(C(C)(C)S(C)(=O)=O)cc3cccnc23)c1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C33H36N2O5S2/c1-32(2,3)35-31(36)29(23-13-15-27(16-14-23)41(6,37)38)19-22-10-8-11-24(18-22)28-21-26(33(4,5)42(7,39)40)20-25-12-9-17-34-30(25)28/h8-21H,1-7H3,(H,35,36)/b29-19+ |
| InChIKey | IJKZCTSWKPQVLH-VUTHCHCSSA-N |
| XLogP | 6.04 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.79 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|