C32H35N3O2S — CID 142071520
(Z)-N,N-dimethyl-3-[3-[6-(2-methyl-1-methyliminopropan-2-yl)quinolin-8-yl]phenyl]-2-(4-methylsulfonylphenyl)prop-2-en-1-amine (PubChem CID 142071520) has the molecular formula C32H35N3O2S and a molecular weight of 525.72 g/mol. Its IUPAC name is (Z)-N,N-dimethyl-3-[3-[6-(2-methyl-1-methyliminopropan-2-yl)quinolin-8-yl]phenyl]-2-(4-methylsulfonylphenyl)prop-2-en-1-amine.
| Compound Name | (Z)-N,N-dimethyl-3-[3-[6-(2-methyl-1-methyliminopropan-2-yl)quinolin-8-yl]phenyl]-2-(4-methylsulfonylphenyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 142071520 |
| Molecular Formula | C32H35N3O2S |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | (Z)-N,N-dimethyl-3-[3-[6-(2-methyl-1-methyliminopropan-2-yl)quinolin-8-yl]phenyl]-2-(4-methylsulfonylphenyl)prop-2-en-1-amine |
| SMILES | C/N=C/C(C)(C)c1cc(-c2cccc(/C=C(\CN(C)C)c3ccc(S(C)(=O)=O)cc3)c2)c2ncccc2c1 |
| InChI | InChI=1S/C32H35N3O2S/c1-32(2,22-33-3)28-19-26-11-8-16-34-31(26)30(20-28)25-10-7-9-23(17-25)18-27(21-35(4)5)24-12-14-29(15-13-24)38(6,36)37/h7-20,22H,21H2,1-6H3/b27-18+,33-22+ |
| InChIKey | RETXGLYQOZGJHQ-ZJLQYDORSA-N |
| XLogP | 6.39 |
| TPSA | 62.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|