C32H32N2O5S2 — CID 10303891
(E)-N-cyclopropyl-2-(4-methylsulfonylphenyl)-3-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]prop-2-enamide (PubChem CID 10303891) has the molecular formula C32H32N2O5S2 and a molecular weight of 588.75 g/mol. Its IUPAC name is (E)-N-cyclopropyl-2-(4-methylsulfonylphenyl)-3-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-cyclopropyl-2-(4-methylsulfonylphenyl)-3-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 10303891 |
| Molecular Formula | C32H32N2O5S2 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | (E)-N-cyclopropyl-2-(4-methylsulfonylphenyl)-3-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]prop-2-enamide |
| SMILES | CC(C)(c1cc(-c2cccc(/C=C(/C(=O)NC3CC3)c3ccc(S(C)(=O)=O)cc3)c2)c2ncccc2c1)S(C)(=O)=O |
| InChI | InChI=1S/C32H32N2O5S2/c1-32(2,41(4,38)39)25-19-24-9-6-16-33-30(24)28(20-25)23-8-5-7-21(17-23)18-29(31(35)34-26-12-13-26)22-10-14-27(15-11-22)40(3,36)37/h5-11,14-20,26H,12-13H2,1-4H3,(H,34,35)/b29-18+ |
| InChIKey | QLKQMKFLJGNHNM-RDRPBHBLSA-N |
| XLogP | 5.40 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|