C32H34N2O5S2 — CID 68882310
2-(4-methylsulfonylphenyl)-3-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]-N-propan-2-ylprop-2-enamide (PubChem CID 68882310) has the molecular formula C32H34N2O5S2 and a molecular weight of 590.77 g/mol. Its IUPAC name is 2-(4-methylsulfonylphenyl)-3-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]-N-propan-2-ylprop-2-enamide.
| Compound Name | 2-(4-methylsulfonylphenyl)-3-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]-N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 68882310 |
| Molecular Formula | C32H34N2O5S2 |
| Molecular Weight | 590.77 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | 2-(4-methylsulfonylphenyl)-3-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]-N-propan-2-ylprop-2-enamide |
| SMILES | CC(C)NC(=O)C(=Cc1cccc(-c2cc(C(C)(C)S(C)(=O)=O)cc3cccnc23)c1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C32H34N2O5S2/c1-21(2)34-31(35)29(23-12-14-27(15-13-23)40(5,36)37)18-22-9-7-10-24(17-22)28-20-26(32(3,4)41(6,38)39)19-25-11-8-16-33-30(25)28/h7-21H,1-6H3,(H,34,35) |
| InChIKey | MFVDHDWORIHHOB-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.77 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|