C23H20ClNO2S2 — CID 10478502
8-[3-(5-chlorothiophen-2-yl)phenyl]-6-(2-methylsulfonylpropan-2-yl)quinoline (PubChem CID 10478502) has the molecular formula C23H20ClNO2S2 and a molecular weight of 442.01 g/mol. Its IUPAC name is 8-[3-(5-chlorothiophen-2-yl)phenyl]-6-(2-methylsulfonylpropan-2-yl)quinoline.
| Compound Name | 8-[3-(5-chlorothiophen-2-yl)phenyl]-6-(2-methylsulfonylpropan-2-yl)quinoline |
|---|---|
| PubChem CID | 10478502 |
| Molecular Formula | C23H20ClNO2S2 |
| Molecular Weight | 442.01 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 8-[3-(5-chlorothiophen-2-yl)phenyl]-6-(2-methylsulfonylpropan-2-yl)quinoline |
| SMILES | CC(C)(c1cc(-c2cccc(-c3ccc(Cl)s3)c2)c2ncccc2c1)S(C)(=O)=O |
| InChI | InChI=1S/C23H20ClNO2S2/c1-23(2,29(3,26)27)18-13-17-8-5-11-25-22(17)19(14-18)15-6-4-7-16(12-15)20-9-10-21(24)28-20/h4-14H,1-3H3 |
| InChIKey | QBZNJVMHQKFVGK-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.01 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |