C27H28N2O3S — CID 69373655
2-[5-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]-3-pyridinyl]propan-2-ol (PubChem CID 69373655) has the molecular formula C27H28N2O3S and a molecular weight of 460.60 g/mol. Its IUPAC name is 2-[5-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]-3-pyridinyl]propan-2-ol.
| Compound Name | 2-[5-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]-3-pyridinyl]propan-2-ol |
|---|---|
| PubChem CID | 69373655 |
| Molecular Formula | C27H28N2O3S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 2-[5-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]-3-pyridinyl]propan-2-ol |
| SMILES | CC(C)(O)c1cncc(-c2cccc(-c3cc(C(C)(C)S(C)(=O)=O)cc4cccnc34)c2)c1 |
| InChI | InChI=1S/C27H28N2O3S/c1-26(2,30)23-14-21(16-28-17-23)18-8-6-9-19(12-18)24-15-22(27(3,4)33(5,31)32)13-20-10-7-11-29-25(20)24/h6-17,30H,1-5H3 |
| InChIKey | XLHDRVYBMOAYJW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |