C16H27N3O5 — CID 142844235
ethene;methyl 4-(ethylamino)-4-oxo-3-[[2-(pent-4-enoylamino)acetyl]amino]butanoate (PubChem CID 142844235) has the molecular formula C16H27N3O5 and a molecular weight of 341.41 g/mol. Its IUPAC name is ethene;methyl 4-(ethylamino)-4-oxo-3-[[2-(pent-4-enoylamino)acetyl]amino]butanoate.
| Compound Name | ethene;methyl 4-(ethylamino)-4-oxo-3-[[2-(pent-4-enoylamino)acetyl]amino]butanoate |
|---|---|
| PubChem CID | 142844235 |
| Molecular Formula | C16H27N3O5 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | ethene;methyl 4-(ethylamino)-4-oxo-3-[[2-(pent-4-enoylamino)acetyl]amino]butanoate |
| SMILES | C=C.C=CCCC(=O)NCC(=O)NC(CC(=O)OC)C(=O)NCC |
| InChI | InChI=1S/C14H23N3O5.C2H4/c1-4-6-7-11(18)16-9-12(19)17-10(8-13(20)22-3)14(21)15-5-2;1-2/h4,10H,1,5-9H2,2-3H3,(H,15,21)(H,16,18)(H,17,19);1-2H2 |
| InChIKey | IXSCDDLWHMIKQP-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|