C12H20N2O5 — CID 58637808
dimethyl 2-[2-(methylamino)pent-4-enoylamino]butanedioate (PubChem CID 58637808) has the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. Its IUPAC name is dimethyl 2-[2-(methylamino)pent-4-enoylamino]butanedioate.
| Compound Name | dimethyl 2-[2-(methylamino)pent-4-enoylamino]butanedioate |
|---|---|
| PubChem CID | 58637808 |
| Molecular Formula | C12H20N2O5 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | dimethyl 2-[2-(methylamino)pent-4-enoylamino]butanedioate |
| SMILES | C=CCC(NC)C(=O)NC(CC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C12H20N2O5/c1-5-6-8(13-2)11(16)14-9(12(17)19-4)7-10(15)18-3/h5,8-9,13H,1,6-7H2,2-4H3,(H,14,16) |
| InChIKey | FWJYDNUDTNBYFH-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|