C21H30O4 — CID 142845279
2-methyl-1-(6'-methylspiro[1,3-dioxolane-2,12'-15-oxatetracyclo[8.4.1.01,10.02,7]pentadec-2-ene]-5'-yl)propan-1-one (PubChem CID 142845279) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-methyl-1-(6'-methylspiro[1,3-dioxolane-2,12'-15-oxatetracyclo[8.4.1.01,10.02,7]pentadec-2-ene]-5'-yl)propan-1-one.
| Compound Name | 2-methyl-1-(6'-methylspiro[1,3-dioxolane-2,12'-15-oxatetracyclo[8.4.1.01,10.02,7]pentadec-2-ene]-5'-yl)propan-1-one |
|---|---|
| PubChem CID | 142845279 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 2-methyl-1-(6'-methylspiro[1,3-dioxolane-2,12'-15-oxatetracyclo[8.4.1.01,10.02,7]pentadec-2-ene]-5'-yl)propan-1-one |
| SMILES | CC(C)C(=O)C1CC=C2C(CCC34CC5(CCC23O4)OCCO5)C1C |
| InChI | InChI=1S/C21H30O4/c1-13(2)18(22)16-4-5-17-15(14(16)3)6-7-19-12-20(23-10-11-24-20)8-9-21(17,19)25-19/h5,13-16H,4,6-12H2,1-3H3 |
| InChIKey | CDBVMNMQDVVKLV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|