C25H42O5 — CID 142846372
2-[4-(4-methoxycyclohexyl)cyclohexyl]oxyethyl (E)-3-(4-methoxycyclohexyl)prop-2-enoate (PubChem CID 142846372) has the molecular formula C25H42O5 and a molecular weight of 422.61 g/mol. Its IUPAC name is 2-[4-(4-methoxycyclohexyl)cyclohexyl]oxyethyl (E)-3-(4-methoxycyclohexyl)prop-2-enoate.
| Compound Name | 2-[4-(4-methoxycyclohexyl)cyclohexyl]oxyethyl (E)-3-(4-methoxycyclohexyl)prop-2-enoate |
|---|---|
| PubChem CID | 142846372 |
| Molecular Formula | C25H42O5 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | 2-[4-(4-methoxycyclohexyl)cyclohexyl]oxyethyl (E)-3-(4-methoxycyclohexyl)prop-2-enoate |
| SMILES | COC1CCC(/C=C/C(=O)OCCOC2CCC(C3CCC(OC)CC3)CC2)CC1 |
| InChI | InChI=1S/C25H42O5/c1-27-22-10-3-19(4-11-22)5-16-25(26)30-18-17-29-24-14-8-21(9-15-24)20-6-12-23(28-2)13-7-20/h5,16,19-24H,3-4,6-15,17-18H2,1-2H3/b16-5+ |
| InChIKey | DISFTXOALNZUSO-FZSIALSZSA-N |
| XLogP | 5.07 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|